About N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium
N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium (PubChem CID 118555129) has the molecular formula C6H17F2NO4PS2+
and a molecular weight of 300.31 g/mol. Its IUPAC name is N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium.
Molecular Properties
| Compound Name | N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium |
| PubChem CID | 118555129 |
| Molecular Formula | C6H17F2NO4PS2+ |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium |
| SMILES | CCC[P+](C)(C)C.O=S(=O)(F)NS(=O)(=O)F |
| InChI | InChI=1S/C6H16P.F2HNO4S2/c1-5-6-7(2,3)4;1-8(4,5)3-9(2,6)7/h5-6H2,1-4H3;3H/q+1; |
| InChIKey | DYXPYAMIAPSUBW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium?
The IUPAC name of N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium (CID 118555129) is N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium.
What is the SMILES notation for N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium?
The canonical SMILES for N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium is CCC[P+](C)(C)C.O=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium?
The InChIKey is DYXPYAMIAPSUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16P.F2HNO4S2/c1-5-6-7(2,3)4;1-8(4,5)3-9(2,6)7/h5-6H2,1-4H3;3H/q+1;.
What are the key properties of N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium?
N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium has a molecular weight of 300.31 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluorosulfonylsulfamoyl fluoride;trimethyl(propyl)phosphanium is sourced from PubChem (CID 118555129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).