About butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride
butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride (PubChem CID 174816119) has the molecular formula C7H19F2N2O4S2+
and a molecular weight of 297.37 g/mol. Its IUPAC name is butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride.
Molecular Properties
| Compound Name | butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride |
| PubChem CID | 174816119 |
| Molecular Formula | C7H19F2N2O4S2+ |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride |
| SMILES | CCCC[N+](C)(C)C.O=S(=O)(F)NS(=O)(=O)F |
| InChI | InChI=1S/C7H18N.F2HNO4S2/c1-5-6-7-8(2,3)4;1-8(4,5)3-9(2,6)7/h5-7H2,1-4H3;3H/q+1; |
| InChIKey | GDJCQAQNBVDIQA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride?
The IUPAC name of butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride (CID 174816119) is butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride.
What is the SMILES notation for butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride?
The canonical SMILES for butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride is CCCC[N+](C)(C)C.O=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride?
The InChIKey is GDJCQAQNBVDIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.F2HNO4S2/c1-5-6-7-8(2,3)4;1-8(4,5)3-9(2,6)7/h5-7H2,1-4H3;3H/q+1;.
What are the key properties of butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride?
butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride has a molecular weight of 297.37 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trimethyl)azanium;N-fluorosulfonylsulfamoyl fluoride is sourced from PubChem (CID 174816119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).