C6H16FNO3S — CID 90333752
CID 90333752 (PubChem CID 90333752) has the molecular formula C6H16FNO3S and a molecular weight of 201.26 g/mol.
| Compound Name | CID 90333752 |
|---|---|
| PubChem CID | 90333752 |
| Molecular Formula | C6H16FNO3S |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | — |
| SMILES | CCC[N+](C)(C)C.O=S(=O)([O-])F |
| InChI | InChI=1S/C6H16N.FHO3S/c1-5-6-7(2,3)4;1-5(2,3)4/h5-6H2,1-4H3;(H,2,3,4)/q+1;/p-1 |
| InChIKey | FWSDNANLFCSOBY-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|