About trifluoromethanesulfonamide;trimethyl(propyl)azanium
trifluoromethanesulfonamide;trimethyl(propyl)azanium (PubChem CID 87657306) has the molecular formula C7H18F3N2O2S+
and a molecular weight of 251.29 g/mol. Its IUPAC name is trifluoromethanesulfonamide;trimethyl(propyl)azanium.
Molecular Properties
| Compound Name | trifluoromethanesulfonamide;trimethyl(propyl)azanium |
| PubChem CID | 87657306 |
| Molecular Formula | C7H18F3N2O2S+ |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | trifluoromethanesulfonamide;trimethyl(propyl)azanium |
| SMILES | CCC[N+](C)(C)C.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H16N.CH2F3NO2S/c1-5-6-7(2,3)4;2-1(3,4)8(5,6)7/h5-6H2,1-4H3;(H2,5,6,7)/q+1; |
| InChIKey | OZPNZCDOMDCYIT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonamide;trimethyl(propyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonamide;trimethyl(propyl)azanium?
The IUPAC name of trifluoromethanesulfonamide;trimethyl(propyl)azanium (CID 87657306) is trifluoromethanesulfonamide;trimethyl(propyl)azanium.
What is the SMILES notation for trifluoromethanesulfonamide;trimethyl(propyl)azanium?
The canonical SMILES for trifluoromethanesulfonamide;trimethyl(propyl)azanium is CCC[N+](C)(C)C.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of trifluoromethanesulfonamide;trimethyl(propyl)azanium?
The InChIKey is OZPNZCDOMDCYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N.CH2F3NO2S/c1-5-6-7(2,3)4;2-1(3,4)8(5,6)7/h5-6H2,1-4H3;(H2,5,6,7)/q+1;.
What are the key properties of trifluoromethanesulfonamide;trimethyl(propyl)azanium?
trifluoromethanesulfonamide;trimethyl(propyl)azanium has a molecular weight of 251.29 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonamide;trimethyl(propyl)azanium is sourced from PubChem (CID 87657306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).