C5H13F3N2O4S2 — CID 87836175
butane-1-sulfonamide;trifluoromethanesulfonamide (PubChem CID 87836175) has the molecular formula C5H13F3N2O4S2 and a molecular weight of 286.30 g/mol. Its IUPAC name is butane-1-sulfonamide;trifluoromethanesulfonamide.
| Compound Name | butane-1-sulfonamide;trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 87836175 |
| Molecular Formula | C5H13F3N2O4S2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | butane-1-sulfonamide;trifluoromethanesulfonamide |
| SMILES | CCCCS(N)(=O)=O.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H11NO2S.CH2F3NO2S/c1-2-3-4-8(5,6)7;2-1(3,4)8(5,6)7/h2-4H2,1H3,(H2,5,6,7);(H2,5,6,7) |
| InChIKey | MGHNTLQRLPLKKF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |