About indigane;trifluoromethanesulfonamide
indigane;trifluoromethanesulfonamide (PubChem CID 174794253) has the molecular formula CH5F3InNO2S
and a molecular weight of 266.93 g/mol. Its IUPAC name is indigane;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | indigane;trifluoromethanesulfonamide |
| PubChem CID | 174794253 |
| Molecular Formula | CH5F3InNO2S |
| Molecular Weight | 266.93 g/mol |
| Exact Mass | 266.90 |
| IUPAC Name | indigane;trifluoromethanesulfonamide |
| SMILES | NS(=O)(=O)C(F)(F)F.[InH3] |
| InChI | InChI=1S/CH2F3NO2S.In.3H/c2-1(3,4)8(5,6)7;;;;/h(H2,5,6,7);;;; |
| InChIKey | DFJTUFRTDLHVAJ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.93 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indigane;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indigane;trifluoromethanesulfonamide?
The IUPAC name of indigane;trifluoromethanesulfonamide (CID 174794253) is indigane;trifluoromethanesulfonamide.
What is the SMILES notation for indigane;trifluoromethanesulfonamide?
The canonical SMILES for indigane;trifluoromethanesulfonamide is NS(=O)(=O)C(F)(F)F.[InH3].
What is the InChIKey of indigane;trifluoromethanesulfonamide?
The InChIKey is DFJTUFRTDLHVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2F3NO2S.In.3H/c2-1(3,4)8(5,6)7;;;;/h(H2,5,6,7);;;;.
What are the key properties of indigane;trifluoromethanesulfonamide?
indigane;trifluoromethanesulfonamide has a molecular weight of 266.93 g/mol, XLogP of -1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indigane;trifluoromethanesulfonamide is sourced from PubChem (CID 174794253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).