About CID 87784182
CID 87784182 (PubChem CID 87784182) has the molecular formula C2H4F6KN2O4S2
and a molecular weight of 337.28 g/mol.
Molecular Properties
| Compound Name | CID 87784182 |
| PubChem CID | 87784182 |
| Molecular Formula | C2H4F6KN2O4S2 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.[K] |
| InChI | InChI=1S/2CH2F3NO2S.K/c2*2-1(3,4)8(5,6)7;/h2*(H2,5,6,7); |
| InChIKey | DXZDTDFCQVMXBT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 87784182 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87784182?
The IUPAC name of CID 87784182 (CID 87784182) is not available.
What is the SMILES notation for CID 87784182?
The canonical SMILES for CID 87784182 is NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.[K].
What is the InChIKey of CID 87784182?
The InChIKey is DXZDTDFCQVMXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH2F3NO2S.K/c2*2-1(3,4)8(5,6)7;/h2*(H2,5,6,7);.
What are the key properties of CID 87784182?
CID 87784182 has a molecular weight of 337.28 g/mol, XLogP of -0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87784182 is sourced from PubChem (CID 87784182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).