About CID 87103721
CID 87103721 (PubChem CID 87103721) has the molecular formula C2H4F6LiN2O4S2
and a molecular weight of 305.13 g/mol.
Molecular Properties
| Compound Name | CID 87103721 |
| PubChem CID | 87103721 |
| Molecular Formula | C2H4F6LiN2O4S2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.[Li] |
| InChI | InChI=1S/2CH2F3NO2S.Li/c2*2-1(3,4)8(5,6)7;/h2*(H2,5,6,7); |
| InChIKey | KOMLXUNAWWFLRU-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 87103721 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87103721?
The IUPAC name of CID 87103721 (CID 87103721) is not available.
What is the SMILES notation for CID 87103721?
The canonical SMILES for CID 87103721 is NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.[Li].
What is the InChIKey of CID 87103721?
The InChIKey is KOMLXUNAWWFLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH2F3NO2S.Li/c2*2-1(3,4)8(5,6)7;/h2*(H2,5,6,7);.
What are the key properties of CID 87103721?
CID 87103721 has a molecular weight of 305.13 g/mol, XLogP of -0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87103721 is sourced from PubChem (CID 87103721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).