C3H3F6NO5S2 — CID 151994142
1,1,2,2,3,3-hexafluoro-3-sulfamoylpropane-1-sulfonic acid (PubChem CID 151994142) has the molecular formula C3H3F6NO5S2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-sulfamoylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-sulfamoylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 151994142 |
| Molecular Formula | C3H3F6NO5S2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-sulfamoylpropane-1-sulfonic acid |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C3H3F6NO5S2/c4-1(5,2(6,7)16(10,11)12)3(8,9)17(13,14)15/h(H2,10,11,12)(H,13,14,15) |
| InChIKey | UFHVGJKRQRJTRK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|