C3HF7O6S2 — CID 91127376
1,1,2,2,3,3-hexafluoro-3-fluorooxysulfonylpropane-1-sulfonic acid (PubChem CID 91127376) has the molecular formula C3HF7O6S2 and a molecular weight of 330.16 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-fluorooxysulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-fluorooxysulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 91127376 |
| Molecular Formula | C3HF7O6S2 |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-fluorooxysulfonylpropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OF |
| InChI | InChI=1S/C3HF7O6S2/c4-1(5,2(6,7)17(11,12)13)3(8,9)18(14,15)16-10/h(H,11,12,13) |
| InChIKey | RIYMFAMDHXIKJZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|