C3H3F6LiN2O4S2 — CID 87784183
lithium (1,1,2,2,3,3-hexafluoro-3-sulfamoylpropyl)sulfonylazanide (PubChem CID 87784183) has the molecular formula C3H3F6LiN2O4S2 and a molecular weight of 316.13 g/mol. Its IUPAC name is lithium (1,1,2,2,3,3-hexafluoro-3-sulfamoylpropyl)sulfonylazanide.
| Compound Name | lithium (1,1,2,2,3,3-hexafluoro-3-sulfamoylpropyl)sulfonylazanide |
|---|---|
| PubChem CID | 87784183 |
| Molecular Formula | C3H3F6LiN2O4S2 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | lithium (1,1,2,2,3,3-hexafluoro-3-sulfamoylpropyl)sulfonylazanide |
| SMILES | [Li+].[NH-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(N)(=O)=O |
| InChI | InChI=1S/C3H3F6N2O4S2.Li/c4-1(5,2(6,7)16(10,12)13)3(8,9)17(11,14)15;/h(H3-,10,11,12,13,14,15);/q-1;+1 |
| InChIKey | SFNQVJLHKBORPR-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|