C3H3F6NO2S — CID 162553244
1,1,2,2,3,3-hexafluoropropane-1-sulfonamide (PubChem CID 162553244) has the molecular formula C3H3F6NO2S and a molecular weight of 231.12 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoropropane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 162553244 |
| Molecular Formula | C3H3F6NO2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoropropane-1-sulfonamide |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C3H3F6NO2S/c4-1(5)2(6,7)3(8,9)13(10,11)12/h1H,(H2,10,11,12) |
| InChIKey | HWFYFFVGPCPMPF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|