C3H4F6N2O4S2 — CID 138683486
1,1,2,3,3,3-hexafluoropropane-1,2-disulfonamide (PubChem CID 138683486) has the molecular formula C3H4F6N2O4S2 and a molecular weight of 310.20 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoropropane-1,2-disulfonamide.
| Compound Name | 1,1,2,3,3,3-hexafluoropropane-1,2-disulfonamide |
|---|---|
| PubChem CID | 138683486 |
| Molecular Formula | C3H4F6N2O4S2 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoropropane-1,2-disulfonamide |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C3H4F6N2O4S2/c4-1(2(5,6)7,16(10,12)13)3(8,9)17(11,14)15/h(H2,10,12,13)(H2,11,14,15) |
| InChIKey | CTWCQONUEHOJKP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |