C6H8F9NO3S — CID 175057047
ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 175057047) has the molecular formula C6H8F9NO3S and a molecular weight of 345.18 g/mol. Its IUPAC name is ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 175057047 |
| Molecular Formula | C6H8F9NO3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | CCO.NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F9NO2S.C2H6O/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-2-3/h(H2,14,15,16);3H,2H2,1H3 |
| InChIKey | INMGYZNSLHTQQU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|