C17H24F17NO5SSi — CID 175073073
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;triethoxy(propyl)silane (PubChem CID 175073073) has the molecular formula C17H24F17NO5SSi and a molecular weight of 705.50 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;triethoxy(propyl)silane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;triethoxy(propyl)silane |
|---|---|
| PubChem CID | 175073073 |
| Molecular Formula | C17H24F17NO5SSi |
| Molecular Weight | 705.50 g/mol |
| Exact Mass | 705.09 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H22O3Si.C8H2F17NO2S/c1-5-9-13(10-6-2,11-7-3)12-8-4;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h5-9H2,1-4H3;(H2,26,27,28) |
| InChIKey | UKOLBLPKEASSFI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|