C11H9F17N2O3S — CID 174701815
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;1-nitrosopropane (PubChem CID 174701815) has the molecular formula C11H9F17N2O3S and a molecular weight of 572.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;1-nitrosopropane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;1-nitrosopropane |
|---|---|
| PubChem CID | 174701815 |
| Molecular Formula | C11H9F17N2O3S |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide;1-nitrosopropane |
| SMILES | CCCN=O.NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F17NO2S.C3H7NO/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28;1-2-3-4-5/h(H2,26,27,28);2-3H2,1H3 |
| InChIKey | PJGSISUHXTXZAT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|