C8H4F16N2O4S2 — CID 87586579
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1,1-disulfonamide (PubChem CID 87586579) has the molecular formula C8H4F16N2O4S2 and a molecular weight of 560.23 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1,1-disulfonamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1,1-disulfonamide |
|---|---|
| PubChem CID | 87586579 |
| Molecular Formula | C8H4F16N2O4S2 |
| Molecular Weight | 560.23 g/mol |
| Exact Mass | 559.94 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1,1-disulfonamide |
| SMILES | NS(=O)(=O)C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C8H4F16N2O4S2/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,31(25,27)28)32(26,29)30/h(H2,25,27,28)(H2,26,29,30) |
| InChIKey | SDWSWUODLXBUHC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|