C9H11F13N2O2SSi — CID 140522451
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[sulfamoyl(trimethylsilyl)amino]hexane (PubChem CID 140522451) has the molecular formula C9H11F13N2O2SSi and a molecular weight of 486.33 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[sulfamoyl(trimethylsilyl)amino]hexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[sulfamoyl(trimethylsilyl)amino]hexane |
|---|---|
| PubChem CID | 140522451 |
| Molecular Formula | C9H11F13N2O2SSi |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[sulfamoyl(trimethylsilyl)amino]hexane |
| SMILES | C[Si](C)(C)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C9H11F13N2O2SSi/c1-28(2,3)24(27(23,25)26)9(21,22)7(16,17)5(12,13)4(10,11)6(14,15)8(18,19)20/h1-3H3,(H2,23,25,26) |
| InChIKey | XIHQHDWELRONIO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|