C3H4F6N2O4S2 — CID 87361345
1,2,2,3,3,3-hexafluoropropane-1,1-disulfonamide (PubChem CID 87361345) has the molecular formula C3H4F6N2O4S2 and a molecular weight of 310.20 g/mol. Its IUPAC name is 1,2,2,3,3,3-hexafluoropropane-1,1-disulfonamide.
| Compound Name | 1,2,2,3,3,3-hexafluoropropane-1,1-disulfonamide |
|---|---|
| PubChem CID | 87361345 |
| Molecular Formula | C3H4F6N2O4S2 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 1,2,2,3,3,3-hexafluoropropane-1,1-disulfonamide |
| SMILES | NS(=O)(=O)C(F)(C(F)(F)C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C3H4F6N2O4S2/c4-1(5,2(6,7)8)3(9,16(10,12)13)17(11,14)15/h(H2,10,12,13)(H2,11,14,15) |
| InChIKey | QVQXFANMXFFEOB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|