C4H4F8N2NaO4S2 — CID 173133738
CID 173133738 (PubChem CID 173133738) has the molecular formula C4H4F8N2NaO4S2 and a molecular weight of 383.19 g/mol.
| Compound Name | CID 173133738 |
|---|---|
| PubChem CID | 173133738 |
| Molecular Formula | C4H4F8N2NaO4S2 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | — |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(N)(=O)=O.[Na] |
| InChI | InChI=1S/C4H4F8N2O4S2.Na/c5-1(6,3(9,10)19(13,15)16)2(7,8)4(11,12)20(14,17)18;/h(H2,13,15,16)(H2,14,17,18); |
| InChIKey | OAFZSXHBSRRUAE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|