C16H21F15O3Si — CID 155607261
diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl)-propoxysilane (PubChem CID 155607261) has the molecular formula C16H21F15O3Si and a molecular weight of 574.40 g/mol. Its IUPAC name is diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl)-propoxysilane.
| Compound Name | diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl)-propoxysilane |
|---|---|
| PubChem CID | 155607261 |
| Molecular Formula | C16H21F15O3Si |
| Molecular Weight | 574.40 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl)-propoxysilane |
| SMILES | CCCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C16H21F15O3Si/c1-4-8-34-35(32-5-2,33-6-3)9-7-10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h4-9H2,1-3H3 |
| InChIKey | IDLZRMCWYYVSPD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.40 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|