C14H22F8O3Si — CID 18008749
triethoxy(3,3,4,4,5,5,6,6-octafluorooct-7-enyl)silane (PubChem CID 18008749) has the molecular formula C14H22F8O3Si and a molecular weight of 418.40 g/mol. Its IUPAC name is triethoxy(3,3,4,4,5,5,6,6-octafluorooct-7-enyl)silane.
| Compound Name | triethoxy(3,3,4,4,5,5,6,6-octafluorooct-7-enyl)silane |
|---|---|
| PubChem CID | 18008749 |
| Molecular Formula | C14H22F8O3Si |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6,6-octafluorooct-7-enyl)silane |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H22F8O3Si/c1-5-11(15,16)13(19,20)14(21,22)12(17,18)9-10-26(23-6-2,24-7-3)25-8-4/h5H,1,6-10H2,2-4H3 |
| InChIKey | NSIHOWXACOOMML-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|