C10H8F12 — CID 19913308
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-1-ene (PubChem CID 19913308) has the molecular formula C10H8F12 and a molecular weight of 356.15 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-1-ene.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-1-ene |
|---|---|
| PubChem CID | 19913308 |
| Molecular Formula | C10H8F12 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC |
| InChI | InChI=1S/C10H8F12/c1-3-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-2/h3H,1,4H2,2H3 |
| InChIKey | GJTCVMRSAJMHMN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|