C6H5F7 — CID 20793154
3,3,4,4,5,5,6-heptafluorohex-1-ene (PubChem CID 20793154) has the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. Its IUPAC name is 3,3,4,4,5,5,6-heptafluorohex-1-ene.
| Compound Name | 3,3,4,4,5,5,6-heptafluorohex-1-ene |
|---|---|
| PubChem CID | 20793154 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3,3,4,4,5,5,6-heptafluorohex-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C6H5F7/c1-2-4(8,9)6(12,13)5(10,11)3-7/h2H,1,3H2 |
| InChIKey | ZZLVHRRTKVGHOI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|