C6H3ClF8 — CID 10923361
6-chloro-3,3,4,4,5,5,6,6-octafluorohex-1-ene (PubChem CID 10923361) has the molecular formula C6H3ClF8 and a molecular weight of 262.53 g/mol. Its IUPAC name is 6-chloro-3,3,4,4,5,5,6,6-octafluorohex-1-ene.
| Compound Name | 6-chloro-3,3,4,4,5,5,6,6-octafluorohex-1-ene |
|---|---|
| PubChem CID | 10923361 |
| Molecular Formula | C6H3ClF8 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 6-chloro-3,3,4,4,5,5,6,6-octafluorohex-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C6H3ClF8/c1-2-3(8,9)4(10,11)5(12,13)6(7,14)15/h2H,1H2 |
| InChIKey | CVTXLGOEFZVUOX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|