C5H2ClF7 — CID 2773786
2-chloro-3,3,4,4,5,5,5-heptafluoropent-1-ene (PubChem CID 2773786) has the molecular formula C5H2ClF7 and a molecular weight of 230.51 g/mol. Its IUPAC name is 2-chloro-3,3,4,4,5,5,5-heptafluoropent-1-ene.
| Compound Name | 2-chloro-3,3,4,4,5,5,5-heptafluoropent-1-ene |
|---|---|
| PubChem CID | 2773786 |
| Molecular Formula | C5H2ClF7 |
| Molecular Weight | 230.51 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 2-chloro-3,3,4,4,5,5,5-heptafluoropent-1-ene |
| SMILES | C=C(Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2ClF7/c1-2(6)3(7,8)4(9,10)5(11,12)13/h1H2 |
| InChIKey | FISQXYDFCVEFII-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|