C5HClF8 — CID 151086807
1-chloro-2,3,3,4,4,5,5,5-octafluoropent-1-ene (PubChem CID 151086807) has the molecular formula C5HClF8 and a molecular weight of 248.50 g/mol. Its IUPAC name is 1-chloro-2,3,3,4,4,5,5,5-octafluoropent-1-ene.
| Compound Name | 1-chloro-2,3,3,4,4,5,5,5-octafluoropent-1-ene |
|---|---|
| PubChem CID | 151086807 |
| Molecular Formula | C5HClF8 |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1-chloro-2,3,3,4,4,5,5,5-octafluoropent-1-ene |
| SMILES | FC(=CCl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HClF8/c6-1-2(7)3(8,9)4(10,11)5(12,13)14/h1H |
| InChIKey | MLGUVWZBCNSDJX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|