C7H2F10O2 — CID 91118314
3,4,4,5,5,6,6,7,7,7-decafluorohept-2-enoic acid (PubChem CID 91118314) has the molecular formula C7H2F10O2 and a molecular weight of 308.07 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,7-decafluorohept-2-enoic acid.
| Compound Name | 3,4,4,5,5,6,6,7,7,7-decafluorohept-2-enoic acid |
|---|---|
| PubChem CID | 91118314 |
| Molecular Formula | C7H2F10O2 |
| Molecular Weight | 308.07 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,7-decafluorohept-2-enoic acid |
| SMILES | O=C(O)C=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F10O2/c8-2(1-3(18)19)4(9,10)5(11,12)6(13,14)7(15,16)17/h1H,(H,18,19) |
| InChIKey | VLQRWBZMXZAWNQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.07 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|