C5HClF7I — CID 173142416
2-chloro-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-ene (PubChem CID 173142416) has the molecular formula C5HClF7I and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-chloro-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-ene.
| Compound Name | 2-chloro-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-ene |
|---|---|
| PubChem CID | 173142416 |
| Molecular Formula | C5HClF7I |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 355.87 |
| IUPAC Name | 2-chloro-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(Cl)=CI |
| InChI | InChI=1S/C5HClF7I/c6-2(1-14)3(7,8)4(9,10)5(11,12)13/h1H |
| InChIKey | MCYPMJXIWUFQJI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|