C5H2F7NO2 — CID 57473814
2,2,3,3,4,4,4-heptafluoro-N-formylbutanamide (PubChem CID 57473814) has the molecular formula C5H2F7NO2 and a molecular weight of 241.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-formylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-formylbutanamide |
|---|---|
| PubChem CID | 57473814 |
| Molecular Formula | C5H2F7NO2 |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-formylbutanamide |
| SMILES | O=CNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2F7NO2/c6-3(7,2(15)13-1-14)4(8,9)5(10,11)12/h1H,(H,13,14,15) |
| InChIKey | IESBUUOJIZZHCY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|