About (E)-1-chloro-1,2-diiodoethene
(E)-1-chloro-1,2-diiodoethene (PubChem CID 87733481) has the molecular formula C2HClI2
and a molecular weight of 314.29 g/mol. Its IUPAC name is (E)-1-chloro-1,2-diiodoethene.
Molecular Properties
| Compound Name | (E)-1-chloro-1,2-diiodoethene |
| PubChem CID | 87733481 |
| Molecular Formula | C2HClI2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.79 |
| IUPAC Name | (E)-1-chloro-1,2-diiodoethene |
| SMILES | Cl/C(I)=C\I |
| InChI | InChI=1S/C2HClI2/c3-2(5)1-4/h1H/b2-1+ |
| InChIKey | RGNOBRHTHOGDHZ-OWOJBTEDSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-chloro-1,2-diiodoethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-chloro-1,2-diiodoethene?
The IUPAC name of (E)-1-chloro-1,2-diiodoethene (CID 87733481) is (E)-1-chloro-1,2-diiodoethene.
What is the SMILES notation for (E)-1-chloro-1,2-diiodoethene?
The canonical SMILES for (E)-1-chloro-1,2-diiodoethene is Cl/C(I)=C\I.
What is the InChIKey of (E)-1-chloro-1,2-diiodoethene?
The InChIKey is RGNOBRHTHOGDHZ-OWOJBTEDSA-N. The full InChI is InChI=1S/C2HClI2/c3-2(5)1-4/h1H/b2-1+.
What are the key properties of (E)-1-chloro-1,2-diiodoethene?
(E)-1-chloro-1,2-diiodoethene has a molecular weight of 314.29 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-chloro-1,2-diiodoethene is sourced from PubChem (CID 87733481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).