C2HI3 — CID 11750092
1,1,2-triiodoethene (PubChem CID 11750092) has the molecular formula C2HI3 and a molecular weight of 405.74 g/mol. Its IUPAC name is 1,1,2-triiodoethene.
| Compound Name | 1,1,2-triiodoethene |
|---|---|
| PubChem CID | 11750092 |
| Molecular Formula | C2HI3 |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 405.72 |
| IUPAC Name | 1,1,2-triiodoethene |
| SMILES | IC=C(I)I |
| InChI | InChI=1S/C2HI3/c3-1-2(4)5/h1H |
| InChIKey | PGHPMTSIGHDLEG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|