C6H3F7O2 — CID 520749
ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 520749) has the molecular formula C6H3F7O2 and a molecular weight of 240.07 g/mol. Its IUPAC name is ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 520749 |
| Molecular Formula | C6H3F7O2 |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C=COC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F7O2/c1-2-15-3(14)4(7,8)5(9,10)6(11,12)13/h2H,1H2 |
| InChIKey | CJABYGHRZGXUKQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|