C5H4F10O2 — CID 139608619
1,1,2,3,3,4,4,5,5,5-decafluoropent-1-ene;dihydrate (PubChem CID 139608619) has the molecular formula C5H4F10O2 and a molecular weight of 286.06 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,5-decafluoropent-1-ene;dihydrate.
| Compound Name | 1,1,2,3,3,4,4,5,5,5-decafluoropent-1-ene;dihydrate |
|---|---|
| PubChem CID | 139608619 |
| Molecular Formula | C5H4F10O2 |
| Molecular Weight | 286.06 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,5-decafluoropent-1-ene;dihydrate |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F.O.O |
| InChI | InChI=1S/C5F10.2H2O/c6-1(2(7)8)3(9,10)4(11,12)5(13,14)15;;/h;2*1H2 |
| InChIKey | MJWABHQJTBSMDW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|