C9F19O2S- — CID 174637308
CID 174637308 (PubChem CID 174637308) has the molecular formula C9F19O2S- and a molecular weight of 533.13 g/mol.
| Compound Name | CID 174637308 |
|---|---|
| PubChem CID | 174637308 |
| Molecular Formula | C9F19O2S- |
| Molecular Weight | 533.13 g/mol |
| Exact Mass | 532.93 |
| IUPAC Name | — |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F.O=S([O-])F |
| InChI | InChI=1S/C9F18.FHO2S/c10-1(2(11)12)3(13,14)5(16,17)4(15,8(22,23)24)6(18,19)7(20,21)9(25,26)27;1-4(2)3/h;(H,2,3)/p-1 |
| InChIKey | CEIAXHBYHXNPAY-UHFFFAOYSA-M |
| XLogP | 6.19 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.13 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|