C3F5O2S- — CID 174654581
1,1,2,3,3-pentafluoroprop-2-ene-1-sulfinate (PubChem CID 174654581) has the molecular formula C3F5O2S- and a molecular weight of 195.09 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoroprop-2-ene-1-sulfinate.
| Compound Name | 1,1,2,3,3-pentafluoroprop-2-ene-1-sulfinate |
|---|---|
| PubChem CID | 174654581 |
| Molecular Formula | C3F5O2S- |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 194.95 |
| IUPAC Name | 1,1,2,3,3-pentafluoroprop-2-ene-1-sulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C3HF5O2S/c4-1(2(5)6)3(7,8)11(9)10/h(H,9,10)/p-1 |
| InChIKey | DENQBLWFBVRSOM-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|