C9H2F17O4S- — CID 174756549
CID 174756549 (PubChem CID 174756549) has the molecular formula C9H2F17O4S- and a molecular weight of 529.14 g/mol.
| Compound Name | CID 174756549 |
|---|---|
| PubChem CID | 174756549 |
| Molecular Formula | C9H2F17O4S- |
| Molecular Weight | 529.14 g/mol |
| Exact Mass | 528.94 |
| IUPAC Name | — |
| SMILES | O=S([O-])F.OC(F)(C(F)=C(F)F)C(F)(F)C(F)(C(F)(F)F)C(O)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2F16O2.FHO2S/c10-1(2(11)12)3(13,26)5(15,16)4(14,8(20,21)22)7(19,27)6(17,18)9(23,24)25;1-4(2)3/h26-27H;(H,2,3)/p-1 |
| InChIKey | OHQPMGYGTXKDHN-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|