C9H3F13O4 — CID 174334537
2,2,3,4,5,5,6,7,8,8-decafluoro-3,6-dihydroxy-4-(trifluoromethyl)oct-7-enoic acid (PubChem CID 174334537) has the molecular formula C9H3F13O4 and a molecular weight of 422.09 g/mol. Its IUPAC name is 2,2,3,4,5,5,6,7,8,8-decafluoro-3,6-dihydroxy-4-(trifluoromethyl)oct-7-enoic acid.
| Compound Name | 2,2,3,4,5,5,6,7,8,8-decafluoro-3,6-dihydroxy-4-(trifluoromethyl)oct-7-enoic acid |
|---|---|
| PubChem CID | 174334537 |
| Molecular Formula | C9H3F13O4 |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 2,2,3,4,5,5,6,7,8,8-decafluoro-3,6-dihydroxy-4-(trifluoromethyl)oct-7-enoic acid |
| SMILES | O=C(O)C(F)(F)C(O)(F)C(F)(C(F)(F)F)C(F)(F)C(O)(F)C(F)=C(F)F |
| InChI | InChI=1S/C9H3F13O4/c10-1(2(11)12)5(15,25)7(17,18)6(16,9(20,21)22)8(19,26)4(13,14)3(23)24/h25-26H,(H,23,24) |
| InChIKey | OSCKEPXAMOQPLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |