C12H4F14O8 — CID 175365907
2,3,3,4,4,4-hexafluorobutane-1,1,1,2-tetracarboxylic acid;1,1,2,3,3,4,4,4-octafluorobut-1-ene (PubChem CID 175365907) has the molecular formula C12H4F14O8 and a molecular weight of 542.13 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexafluorobutane-1,1,1,2-tetracarboxylic acid;1,1,2,3,3,4,4,4-octafluorobut-1-ene.
| Compound Name | 2,3,3,4,4,4-hexafluorobutane-1,1,1,2-tetracarboxylic acid;1,1,2,3,3,4,4,4-octafluorobut-1-ene |
|---|---|
| PubChem CID | 175365907 |
| Molecular Formula | C12H4F14O8 |
| Molecular Weight | 542.13 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2,3,3,4,4,4-hexafluorobutane-1,1,1,2-tetracarboxylic acid;1,1,2,3,3,4,4,4-octafluorobut-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)F.O=C(O)C(C(=O)O)(C(=O)O)C(F)(C(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F6O8.C4F8/c9-6(4(21)22,7(10,11)8(12,13)14)5(1(15)16,2(17)18)3(19)20;5-1(2(6)7)3(8,9)4(10,11)12/h(H,15,16)(H,17,18)(H,19,20)(H,21,22); |
| InChIKey | QVVXYSMZBAUYNW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|