C8HF13O2 — CID 173101382
3,4,5,5,6,6,6-heptafluoro-2,4-bis(trifluoromethyl)hex-2-enoic acid (PubChem CID 173101382) has the molecular formula C8HF13O2 and a molecular weight of 376.07 g/mol. Its IUPAC name is 3,4,5,5,6,6,6-heptafluoro-2,4-bis(trifluoromethyl)hex-2-enoic acid.
| Compound Name | 3,4,5,5,6,6,6-heptafluoro-2,4-bis(trifluoromethyl)hex-2-enoic acid |
|---|---|
| PubChem CID | 173101382 |
| Molecular Formula | C8HF13O2 |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 3,4,5,5,6,6,6-heptafluoro-2,4-bis(trifluoromethyl)hex-2-enoic acid |
| SMILES | O=C(O)C(=C(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF13O2/c9-2(1(3(22)23)5(11,12)13)4(10,7(16,17)18)6(14,15)8(19,20)21/h(H,22,23) |
| InChIKey | HLCMFHPQUOQCJE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|