C14H9F17O2 — CID 173018130
3,4,4,5,5,6,6,7,7,8,8,13,13,13-tetradecafluoro-2-(trifluoromethyl)tridec-2-enoic acid (PubChem CID 173018130) has the molecular formula C14H9F17O2 and a molecular weight of 532.19 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,8,8,13,13,13-tetradecafluoro-2-(trifluoromethyl)tridec-2-enoic acid.
| Compound Name | 3,4,4,5,5,6,6,7,7,8,8,13,13,13-tetradecafluoro-2-(trifluoromethyl)tridec-2-enoic acid |
|---|---|
| PubChem CID | 173018130 |
| Molecular Formula | C14H9F17O2 |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,8,8,13,13,13-tetradecafluoro-2-(trifluoromethyl)tridec-2-enoic acid |
| SMILES | O=C(O)C(=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H9F17O2/c15-6(5(7(32)33)11(23,24)25)10(21,22)13(28,29)14(30,31)12(26,27)8(16,17)3-1-2-4-9(18,19)20/h1-4H2,(H,32,33) |
| InChIKey | OZYJSIUADJVHHE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|