C8H2F12O3 — CID 160557133
4-[difluoro(hydroxy)methyl]-3,5,5,5-tetrafluoro-2,4-bis(trifluoromethyl)pent-2-enoic acid (PubChem CID 160557133) has the molecular formula C8H2F12O3 and a molecular weight of 374.08 g/mol. Its IUPAC name is 4-[difluoro(hydroxy)methyl]-3,5,5,5-tetrafluoro-2,4-bis(trifluoromethyl)pent-2-enoic acid.
| Compound Name | 4-[difluoro(hydroxy)methyl]-3,5,5,5-tetrafluoro-2,4-bis(trifluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 160557133 |
| Molecular Formula | C8H2F12O3 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 4-[difluoro(hydroxy)methyl]-3,5,5,5-tetrafluoro-2,4-bis(trifluoromethyl)pent-2-enoic acid |
| SMILES | O=C(O)C(=C(F)C(C(O)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12O3/c9-2(1(3(21)22)5(10,11)12)4(6(13,14)15,7(16,17)18)8(19,20)23/h23H,(H,21,22) |
| InChIKey | QYVIGPMHBWBOSL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|