C5F10O — CID 12585986
3,3,3-Trifluoro-2,2-bis(trifluoromethyl)propanoyl fluoride (PubChem CID 12585986) has the molecular formula C5F10O and a molecular weight of 266.04 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanoyl fluoride.
| Compound Name | 3,3,3-Trifluoro-2,2-bis(trifluoromethyl)propanoyl fluoride |
|---|---|
| PubChem CID | 12585986 |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanoyl fluoride |
| SMILES | C(=O)(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)F |
| InChI | InChI=1S/C5F10O/c6-1(16)2(3(7,8)9,4(10,11)12)5(13,14)15 |
| InChIKey | HRJYQKAJBSOOOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 243 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|