C11HF17O2 — CID 163324832
(2E,4E)-2,3,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundeca-2,4-dienoic acid (PubChem CID 163324832) has the molecular formula C11HF17O2 and a molecular weight of 488.09 g/mol. Its IUPAC name is (2E,4E)-2,3,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundeca-2,4-dienoic acid.
| Compound Name | (2E,4E)-2,3,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 163324832 |
| Molecular Formula | C11HF17O2 |
| Molecular Weight | 488.09 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | (2E,4E)-2,3,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundeca-2,4-dienoic acid |
| SMILES | O=C(O)/C(F)=C(F)/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11HF17O2/c12-1(3(14)5(29)30)2(13)4(15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h(H,29,30)/b3-1+,4-2+ |
| InChIKey | ZUEFTCZUSVGCSY-ZPUQHVIOSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.09 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|