C9H12F5O2S- — CID 89197566
3,3,5,6,6-pentafluoro-2,4,4-trimethylhex-5-ene-2-sulfinate (PubChem CID 89197566) has the molecular formula C9H12F5O2S- and a molecular weight of 279.25 g/mol. Its IUPAC name is 3,3,5,6,6-pentafluoro-2,4,4-trimethylhex-5-ene-2-sulfinate.
| Compound Name | 3,3,5,6,6-pentafluoro-2,4,4-trimethylhex-5-ene-2-sulfinate |
|---|---|
| PubChem CID | 89197566 |
| Molecular Formula | C9H12F5O2S- |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3,3,5,6,6-pentafluoro-2,4,4-trimethylhex-5-ene-2-sulfinate |
| SMILES | CC(C)(C(F)=C(F)F)C(F)(F)C(C)(C)S(=O)[O-] |
| InChI | InChI=1S/C9H13F5O2S/c1-7(2,5(10)6(11)12)9(13,14)8(3,4)17(15)16/h1-4H3,(H,15,16)/p-1 |
| InChIKey | ZBUKHYMNNYJVRE-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|