C5H7F5O2S — CID 87602942
1,1,2,2,3-pentafluoro-3-methylbutane-1-sulfinic acid (PubChem CID 87602942) has the molecular formula C5H7F5O2S and a molecular weight of 226.17 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-3-methylbutane-1-sulfinic acid.
| Compound Name | 1,1,2,2,3-pentafluoro-3-methylbutane-1-sulfinic acid |
|---|---|
| PubChem CID | 87602942 |
| Molecular Formula | C5H7F5O2S |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-3-methylbutane-1-sulfinic acid |
| SMILES | CC(C)(F)C(F)(F)C(F)(F)S(=O)O |
| InChI | InChI=1S/C5H7F5O2S/c1-3(2,6)4(7,8)5(9,10)13(11)12/h1-2H3,(H,11,12) |
| InChIKey | FLUFWFOWVQDULL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|