C4H5F6NO6S3 — CID 123339020
1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfinic acid (PubChem CID 123339020) has the molecular formula C4H5F6NO6S3 and a molecular weight of 373.27 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfinic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfinic acid |
|---|---|
| PubChem CID | 123339020 |
| Molecular Formula | C4H5F6NO6S3 |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propane-1-sulfinic acid |
| SMILES | CS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)O |
| InChI | InChI=1S/C4H5F6NO6S3/c1-19(14,15)11-20(16,17)4(9,10)2(5,6)3(7,8)18(12)13/h11H,1H3,(H,12,13) |
| InChIKey | AHWZSYCRJKSQKE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|