C3H2F6O2S2 — CID 162554930
1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid (PubChem CID 162554930) has the molecular formula C3H2F6O2S2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid |
|---|---|
| PubChem CID | 162554930 |
| Molecular Formula | C3H2F6O2S2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid |
| SMILES | O=S(O)C(F)(F)C(F)(F)C(F)(F)S |
| InChI | InChI=1S/C3H2F6O2S2/c4-1(5,2(6,7)12)3(8,9)13(10)11/h12H,(H,10,11) |
| InChIKey | GWHCRUWLUSAEOE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|