1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid

C3H2F6O2S2 — CID 162554930

IUPAC1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid
SMILESO=S(O)C(F)(F)C(F)(F)C(F)(F)S
InChIInChI=1S/C3H2F6O2S2/c4-1(5,2(6,7)12)3(8,9)13(10)11/h12H,(H,10,11)
InChIKeyGWHCRUWLUSAEOE-UHFFFAOYSA-N
MW248.17 g/mol
LogP1.96
Rot. Bonds3

About 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid

1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid (PubChem CID 162554930) has the molecular formula C3H2F6O2S2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid.

Molecular Properties

Compound Name1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid
PubChem CID162554930
Molecular FormulaC3H2F6O2S2
Molecular Weight248.17 g/mol
Exact Mass247.94
IUPAC Name1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid
SMILESO=S(O)C(F)(F)C(F)(F)C(F)(F)S
InChIInChI=1S/C3H2F6O2S2/c4-1(5,2(6,7)12)3(8,9)13(10)11/h12H,(H,10,11)
InChIKeyGWHCRUWLUSAEOE-UHFFFAOYSA-N
XLogP1.96
TPSA37.30 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.17
LogP ≤ 51.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid?
The IUPAC name of 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid (CID 162554930) is 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid.
What is the SMILES notation for 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid?
The canonical SMILES for 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid is O=S(O)C(F)(F)C(F)(F)C(F)(F)S.
What is the InChIKey of 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid?
The InChIKey is GWHCRUWLUSAEOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2F6O2S2/c4-1(5,2(6,7)12)3(8,9)13(10)11/h12H,(H,10,11).
What are the key properties of 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid?
1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid has a molecular weight of 248.17 g/mol, XLogP of 1.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2,3,3-hexafluoro-3-sulfanylpropane-1-sulfinic acid is sourced from PubChem (CID 162554930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).