C8H14F4O3S — CID 58037034
1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfinic acid (PubChem CID 58037034) has the molecular formula C8H14F4O3S and a molecular weight of 266.26 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfinic acid.
| Compound Name | 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfinic acid |
|---|---|
| PubChem CID | 58037034 |
| Molecular Formula | C8H14F4O3S |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfinic acid |
| SMILES | O=S(O)C(F)(F)C(F)(F)CCCCCCO |
| InChI | InChI=1S/C8H14F4O3S/c9-7(10,8(11,12)16(14)15)5-3-1-2-4-6-13/h13H,1-6H2,(H,14,15) |
| InChIKey | WYMFIVALPWVSSX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|