C9H13F7O — CID 2776192
7,8,8,8-tetrafluoro-7-(trifluoromethyl)octan-1-ol (PubChem CID 2776192) has the molecular formula C9H13F7O and a molecular weight of 270.19 g/mol. Its IUPAC name is 7,8,8,8-tetrafluoro-7-(trifluoromethyl)octan-1-ol.
| Compound Name | 7,8,8,8-tetrafluoro-7-(trifluoromethyl)octan-1-ol |
|---|---|
| PubChem CID | 2776192 |
| Molecular Formula | C9H13F7O |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 7,8,8,8-tetrafluoro-7-(trifluoromethyl)octan-1-ol |
| SMILES | OCCCCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F7O/c10-7(8(11,12)13,9(14,15)16)5-3-1-2-4-6-17/h17H,1-6H2 |
| InChIKey | GQUBVUFBTNFEHA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|